C18H13F3N2O2S2 — CID 21463541
2-[N-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanethioyl]anilino]acetic acid (PubChem CID 21463541) has the molecular formula C18H13F3N2O2S2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-[N-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanethioyl]anilino]acetic acid.
| Compound Name | 2-[N-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanethioyl]anilino]acetic acid |
|---|---|
| PubChem CID | 21463541 |
| Molecular Formula | C18H13F3N2O2S2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 2-[N-[3-(4,5,7-trifluoro-1,3-benzothiazol-2-yl)propanethioyl]anilino]acetic acid |
| SMILES | O=C(O)CN(C(=S)CCc1nc2c(F)c(F)cc(F)c2s1)c1ccccc1 |
| InChI | InChI=1S/C18H13F3N2O2S2/c19-11-8-12(20)18-17(16(11)21)22-13(27-18)6-7-14(26)23(9-15(24)25)10-4-2-1-3-5-10/h1-5,8H,6-7,9H2,(H,24,25) |
| InChIKey | ILCWJPZBGKLKEM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|