C16H9BrF3NO2S — CID 21463571
2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetic acid (PubChem CID 21463571) has the molecular formula C16H9BrF3NO2S and a molecular weight of 416.22 g/mol. Its IUPAC name is 2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetic acid.
| Compound Name | 2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 21463571 |
| Molecular Formula | C16H9BrF3NO2S |
| Molecular Weight | 416.22 g/mol |
| Exact Mass | 414.95 |
| IUPAC Name | 2-[3-bromo-5-[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1cc(Br)cc(Cc2nc3c(F)c(F)cc(F)c3s2)c1 |
| InChI | InChI=1S/C16H9BrF3NO2S/c17-9-2-7(1-8(3-9)5-13(22)23)4-12-21-15-14(20)10(18)6-11(19)16(15)24-12/h1-3,6H,4-5H2,(H,22,23) |
| InChIKey | JVMPLKHBWUSGJJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|