C11H3ClF9N — CID 21463671
2-chloro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzonitrile (PubChem CID 21463671) has the molecular formula C11H3ClF9N and a molecular weight of 355.59 g/mol. Its IUPAC name is 2-chloro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzonitrile.
| Compound Name | 2-chloro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzonitrile |
|---|---|
| PubChem CID | 21463671 |
| Molecular Formula | C11H3ClF9N |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 2-chloro-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C11H3ClF9N/c12-7-2-1-6(3-5(7)4-22)8(13,14)9(15,16)10(17,18)11(19,20)21/h1-3H |
| InChIKey | ZAGSTOJPCHUANY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|