About magnesium;2-methanidyl-2-methylpropane;propane
magnesium;2-methanidyl-2-methylpropane;propane (PubChem CID 21463987) has the molecular formula C8H18Mg
and a molecular weight of 138.54 g/mol. Its IUPAC name is magnesium;2-methanidyl-2-methylpropane;propane.
Molecular Properties
| Compound Name | magnesium;2-methanidyl-2-methylpropane;propane |
| PubChem CID | 21463987 |
| Molecular Formula | C8H18Mg |
| Molecular Weight | 138.54 g/mol |
| Exact Mass | 138.13 |
| IUPAC Name | magnesium;2-methanidyl-2-methylpropane;propane |
| SMILES | C[CH-]C.[CH2-]C(C)(C)C.[Mg+2] |
| InChI | InChI=1S/C5H11.C3H7.Mg/c1-5(2,3)4;1-3-2;/h1H2,2-4H3;3H,1-2H3;/q2*-1;+2 |
| InChIKey | YCEYHDYYHKOLEY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-methanidyl-2-methylpropane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-methanidyl-2-methylpropane;propane?
The IUPAC name of magnesium;2-methanidyl-2-methylpropane;propane (CID 21463987) is magnesium;2-methanidyl-2-methylpropane;propane.
What is the SMILES notation for magnesium;2-methanidyl-2-methylpropane;propane?
The canonical SMILES for magnesium;2-methanidyl-2-methylpropane;propane is C[CH-]C.[CH2-]C(C)(C)C.[Mg+2].
What is the InChIKey of magnesium;2-methanidyl-2-methylpropane;propane?
The InChIKey is YCEYHDYYHKOLEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.C3H7.Mg/c1-5(2,3)4;1-3-2;/h1H2,2-4H3;3H,1-2H3;/q2*-1;+2.
What are the key properties of magnesium;2-methanidyl-2-methylpropane;propane?
magnesium;2-methanidyl-2-methylpropane;propane has a molecular weight of 138.54 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-methanidyl-2-methylpropane;propane is sourced from PubChem (CID 21463987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).