C7H5Cl2N3O3S — CID 21464365
5-chloro-8-methoxy-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride (PubChem CID 21464365) has the molecular formula C7H5Cl2N3O3S and a molecular weight of 282.11 g/mol. Its IUPAC name is 5-chloro-8-methoxy-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride.
| Compound Name | 5-chloro-8-methoxy-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 21464365 |
| Molecular Formula | C7H5Cl2N3O3S |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 280.94 |
| IUPAC Name | 5-chloro-8-methoxy-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonyl chloride |
| SMILES | COc1ccc(Cl)n2nc(S(=O)(=O)Cl)nc12 |
| InChI | InChI=1S/C7H5Cl2N3O3S/c1-15-4-2-3-5(8)12-6(4)10-7(11-12)16(9,13)14/h2-3H,1H3 |
| InChIKey | MYDNKLVEOZFADV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|