C14H13ClFN5O3S — CID 21464383
6-chloro-8-ethoxy-N-(2-fluoro-4-methyl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide (PubChem CID 21464383) has the molecular formula C14H13ClFN5O3S and a molecular weight of 385.81 g/mol. Its IUPAC name is 6-chloro-8-ethoxy-N-(2-fluoro-4-methyl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide.
| Compound Name | 6-chloro-8-ethoxy-N-(2-fluoro-4-methyl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 21464383 |
| Molecular Formula | C14H13ClFN5O3S |
| Molecular Weight | 385.81 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 6-chloro-8-ethoxy-N-(2-fluoro-4-methyl-3-pyridinyl)-[1,2,4]triazolo[1,5-a]pyridine-2-sulfonamide |
| SMILES | CCOc1cc(Cl)cn2nc(S(=O)(=O)Nc3c(C)ccnc3F)nc12 |
| InChI | InChI=1S/C14H13ClFN5O3S/c1-3-24-10-6-9(15)7-21-13(10)18-14(19-21)25(22,23)20-11-8(2)4-5-17-12(11)16/h4-7,20H,3H2,1-2H3 |
| InChIKey | RYSPFIYHWXWQQV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.81 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|