About (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate
(3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate (PubChem CID 21464597) has the molecular formula C22H24F2O2
and a molecular weight of 358.43 g/mol. Its IUPAC name is (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate.
Molecular Properties
| Compound Name | (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate |
| PubChem CID | 21464597 |
| Molecular Formula | C22H24F2O2 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate |
| SMILES | CCCC1CCC(c2ccc(C(=O)Oc3ccc(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H24F2O2/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)22(25)26-19-12-13-20(23)21(24)14-19/h8-16H,2-7H2,1H3 |
| InChIKey | IQLRFJMGWZXTJA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate?
The IUPAC name of (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate (CID 21464597) is (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate.
What is the SMILES notation for (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate?
The canonical SMILES for (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate is CCCC1CCC(c2ccc(C(=O)Oc3ccc(F)c(F)c3)cc2)CC1.
What is the InChIKey of (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate?
The InChIKey is IQLRFJMGWZXTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24F2O2/c1-2-3-15-4-6-16(7-5-15)17-8-10-18(11-9-17)22(25)26-19-12-13-20(23)21(24)14-19/h8-16H,2-7H2,1H3.
What are the key properties of (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate?
(3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate has a molecular weight of 358.43 g/mol, XLogP of 6.26, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl) 4-(4-propylcyclohexyl)benzoate is sourced from PubChem (CID 21464597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).