C12H16O11P2S — CID 21465009
2-(4-methylsulfinylphenyl)-2,4-diphosphonopentanedioic acid (PubChem CID 21465009) has the molecular formula C12H16O11P2S and a molecular weight of 430.26 g/mol. Its IUPAC name is 2-(4-methylsulfinylphenyl)-2,4-diphosphonopentanedioic acid.
| Compound Name | 2-(4-methylsulfinylphenyl)-2,4-diphosphonopentanedioic acid |
|---|---|
| PubChem CID | 21465009 |
| Molecular Formula | C12H16O11P2S |
| Molecular Weight | 430.26 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 2-(4-methylsulfinylphenyl)-2,4-diphosphonopentanedioic acid |
| SMILES | CS(=O)c1ccc(C(CC(C(=O)O)P(=O)(O)O)(C(=O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C12H16O11P2S/c1-26(23)8-4-2-7(3-5-8)12(11(15)16,25(20,21)22)6-9(10(13)14)24(17,18)19/h2-5,9H,6H2,1H3,(H,13,14)(H,15,16)(H2,17,18,19)(H2,20,21,22) |
| InChIKey | UYDJUEKETBRXKK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|