About 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium
4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium (PubChem CID 21465034) has the molecular formula C8H18BrN2+
and a molecular weight of 222.15 g/mol. Its IUPAC name is 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium.
Molecular Properties
| Compound Name | 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium |
| PubChem CID | 21465034 |
| Molecular Formula | C8H18BrN2+ |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium |
| SMILES | C[N+]1(C)CCN(CCBr)CC1 |
| InChI | InChI=1S/C8H18BrN2/c1-11(2)7-5-10(4-3-9)6-8-11/h3-8H2,1-2H3/q+1 |
| InChIKey | WWYSOHASUFJTBW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium?
The IUPAC name of 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium (CID 21465034) is 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium.
What is the SMILES notation for 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium?
The canonical SMILES for 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium is C[N+]1(C)CCN(CCBr)CC1.
What is the InChIKey of 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium?
The InChIKey is WWYSOHASUFJTBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18BrN2/c1-11(2)7-5-10(4-3-9)6-8-11/h3-8H2,1-2H3/q+1.
What are the key properties of 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium?
4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium has a molecular weight of 222.15 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoethyl)-1,1-dimethylpiperazin-1-ium is sourced from PubChem (CID 21465034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).