C17H12FN3O — CID 21465315
8-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol (PubChem CID 21465315) has the molecular formula C17H12FN3O and a molecular weight of 293.30 g/mol. Its IUPAC name is 8-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol.
| Compound Name | 8-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol |
|---|---|
| PubChem CID | 21465315 |
| Molecular Formula | C17H12FN3O |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 8-[(2-fluoro-4-pyridinyl)methyl]-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-ol |
| SMILES | OC1(Cc2ccnc(F)c2)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C17H12FN3O/c18-14-9-11(5-8-19-14)10-17(22)12-3-1-6-20-15(12)16-13(17)4-2-7-21-16/h1-9,22H,10H2 |
| InChIKey | VAWBGMIFFAHWCE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|