C10H8F7NO2 — CID 21465630
methyl 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrrole-2-carboxylate (PubChem CID 21465630) has the molecular formula C10H8F7NO2 and a molecular weight of 307.17 g/mol. Its IUPAC name is methyl 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 21465630 |
| Molecular Formula | C10H8F7NO2 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | methyl 5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(F)(C(F)(F)F)C(F)(F)F)n1C |
| InChI | InChI=1S/C10H8F7NO2/c1-18-5(7(19)20-2)3-4-6(18)8(11,9(12,13)14)10(15,16)17/h3-4H,1-2H3 |
| InChIKey | UQZGAPASFDWXSQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |