About 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol
4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol (PubChem CID 21466615) has the molecular formula C20H24O4
and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol |
| PubChem CID | 21466615 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol |
| SMILES | CCC1(C)CC(CC)(c2ccc(O)cc2O)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C20H24O4/c1-4-19(3)12-20(5-2,15-8-6-13(21)10-17(15)23)24-18-11-14(22)7-9-16(18)19/h6-11,21-23H,4-5,12H2,1-3H3 |
| InChIKey | DGOKBMAADFCMRY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol?
The IUPAC name of 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol (CID 21466615) is 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol.
What is the SMILES notation for 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol?
The canonical SMILES for 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol is CCC1(C)CC(CC)(c2ccc(O)cc2O)Oc2cc(O)ccc21.
What is the InChIKey of 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol?
The InChIKey is DGOKBMAADFCMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O4/c1-4-19(3)12-20(5-2,15-8-6-13(21)10-17(15)23)24-18-11-14(22)7-9-16(18)19/h6-11,21-23H,4-5,12H2,1-3H3.
What are the key properties of 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol?
4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol has a molecular weight of 328.41 g/mol, XLogP of 4.56, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-diethyl-7-hydroxy-4-methyl-3H-chromen-2-yl)benzene-1,3-diol is sourced from PubChem (CID 21466615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).