C24H26ClI3N2O11 — CID 21466693
[3-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]-2-acetyloxypropyl] acetate (PubChem CID 21466693) has the molecular formula C24H26ClI3N2O11 and a molecular weight of 934.64 g/mol. Its IUPAC name is [3-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]-2-acetyloxypropyl] acetate.
| Compound Name | [3-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]-2-acetyloxypropyl] acetate |
|---|---|
| PubChem CID | 21466693 |
| Molecular Formula | C24H26ClI3N2O11 |
| Molecular Weight | 934.64 g/mol |
| Exact Mass | 933.84 |
| IUPAC Name | [3-[[3-[acetyl(2,3-diacetyloxypropyl)amino]-5-carbonochloridoyl-2,4,6-triiodobenzoyl]amino]-2-acetyloxypropyl] acetate |
| SMILES | CC(=O)OCC(CNC(=O)c1c(I)c(C(=O)Cl)c(I)c(N(CC(COC(C)=O)OC(C)=O)C(C)=O)c1I)OC(C)=O |
| InChI | InChI=1S/C24H26ClI3N2O11/c1-10(31)30(7-16(41-14(5)35)9-39-12(3)33)22-20(27)17(23(25)36)19(26)18(21(22)28)24(37)29-6-15(40-13(4)34)8-38-11(2)32/h15-16H,6-9H2,1-5H3,(H,29,37) |
| InChIKey | CEBWAUIZDZTQLC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|