About 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile
4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile (PubChem CID 21466910) has the molecular formula C8Cl2N4O4
and a molecular weight of 287.02 g/mol. Its IUPAC name is 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile |
| PubChem CID | 21466910 |
| Molecular Formula | C8Cl2N4O4 |
| Molecular Weight | 287.02 g/mol |
| Exact Mass | 285.93 |
| IUPAC Name | 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c([N+](=O)[O-])c(Cl)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8Cl2N4O4/c9-5-6(10)8(14(17)18)4(2-12)3(1-11)7(5)13(15)16 |
| InChIKey | HCKKWGKUQBYMSN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 133.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.02 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile (CID 21466910) is 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile is N#Cc1c(C#N)c([N+](=O)[O-])c(Cl)c(Cl)c1[N+](=O)[O-].
What is the InChIKey of 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile?
The InChIKey is HCKKWGKUQBYMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8Cl2N4O4/c9-5-6(10)8(14(17)18)4(2-12)3(1-11)7(5)13(15)16.
What are the key properties of 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile?
4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile has a molecular weight of 287.02 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3,6-dinitrobenzene-1,2-dicarbonitrile is sourced from PubChem (CID 21466910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).