About butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate
butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate (PubChem CID 21466968) has the molecular formula C16H20ClO4S-
and a molecular weight of 343.85 g/mol. Its IUPAC name is butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate.
Molecular Properties
| Compound Name | butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate |
| PubChem CID | 21466968 |
| Molecular Formula | C16H20ClO4S- |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate |
| SMILES | CCCC.O=C([O-])CC1(C(=O)O)CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H11ClO4S.C4H10/c13-7-1-2-9-8(5-7)12(11(16)17,3-4-18-9)6-10(14)15;1-3-4-2/h1-2,5H,3-4,6H2,(H,14,15)(H,16,17);3-4H2,1-2H3/p-1 |
| InChIKey | HVOQHESVQNQPMF-UHFFFAOYSA-M |
| XLogP | 3.10 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate?
The IUPAC name of butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate (CID 21466968) is butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate.
What is the SMILES notation for butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate?
The canonical SMILES for butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate is CCCC.O=C([O-])CC1(C(=O)O)CCSc2ccc(Cl)cc21.
What is the InChIKey of butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate?
The InChIKey is HVOQHESVQNQPMF-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H11ClO4S.C4H10/c13-7-1-2-9-8(5-7)12(11(16)17,3-4-18-9)6-10(14)15;1-3-4-2/h1-2,5H,3-4,6H2,(H,14,15)(H,16,17);3-4H2,1-2H3/p-1.
What are the key properties of butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate?
butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate has a molecular weight of 343.85 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-(4-carboxy-6-chloro-2,3-dihydrothiochromen-4-yl)acetate is sourced from PubChem (CID 21466968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).