About N-methylacetamide;propan-2-one
N-methylacetamide;propan-2-one (PubChem CID 21466986) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is N-methylacetamide;propan-2-one.
Molecular Properties
| Compound Name | N-methylacetamide;propan-2-one |
| PubChem CID | 21466986 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | N-methylacetamide;propan-2-one |
| SMILES | CC(C)=O.CNC(C)=O |
| InChI | InChI=1S/C3H7NO.C3H6O/c1-3(5)4-2;1-3(2)4/h1-2H3,(H,4,5);1-2H3 |
| InChIKey | KVVYVTXIPBCSQO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methylacetamide;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;propan-2-one?
The IUPAC name of N-methylacetamide;propan-2-one (CID 21466986) is N-methylacetamide;propan-2-one.
What is the SMILES notation for N-methylacetamide;propan-2-one?
The canonical SMILES for N-methylacetamide;propan-2-one is CC(C)=O.CNC(C)=O.
What is the InChIKey of N-methylacetamide;propan-2-one?
The InChIKey is KVVYVTXIPBCSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C3H6O/c1-3(5)4-2;1-3(2)4/h1-2H3,(H,4,5);1-2H3.
What are the key properties of N-methylacetamide;propan-2-one?
N-methylacetamide;propan-2-one has a molecular weight of 131.17 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;propan-2-one is sourced from PubChem (CID 21466986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).