About 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline
6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline (PubChem CID 21467278) has the molecular formula C18H16BrClFN
and a molecular weight of 380.69 g/mol. Its IUPAC name is 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline.
Molecular Properties
| Compound Name | 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline |
| PubChem CID | 21467278 |
| Molecular Formula | C18H16BrClFN |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline |
| SMILES | CN1c2ccc(-c3cc(F)cc(Br)c3Cl)cc2C=CC1(C)C |
| InChI | InChI=1S/C18H16BrClFN/c1-18(2)7-6-12-8-11(4-5-16(12)22(18)3)14-9-13(21)10-15(19)17(14)20/h4-10H,1-3H3 |
| InChIKey | RNWKOCONYKTFQY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline?
The IUPAC name of 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline (CID 21467278) is 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline.
What is the SMILES notation for 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline?
The canonical SMILES for 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline is CN1c2ccc(-c3cc(F)cc(Br)c3Cl)cc2C=CC1(C)C.
What is the InChIKey of 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline?
The InChIKey is RNWKOCONYKTFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BrClFN/c1-18(2)7-6-12-8-11(4-5-16(12)22(18)3)14-9-13(21)10-15(19)17(14)20/h4-10H,1-3H3.
What are the key properties of 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline?
6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline has a molecular weight of 380.69 g/mol, XLogP of 6.15, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-bromo-2-chloro-5-fluorophenyl)-1,2,2-trimethylquinoline is sourced from PubChem (CID 21467278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).