C19H12F3N3O4S — CID 21467459
1-(4-sulfamoylphenyl)-3-(trifluoromethyl)benzo[g]indazole-7-carboxylic acid (PubChem CID 21467459) has the molecular formula C19H12F3N3O4S and a molecular weight of 435.38 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-(trifluoromethyl)benzo[g]indazole-7-carboxylic acid.
| Compound Name | 1-(4-sulfamoylphenyl)-3-(trifluoromethyl)benzo[g]indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 21467459 |
| Molecular Formula | C19H12F3N3O4S |
| Molecular Weight | 435.38 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-(trifluoromethyl)benzo[g]indazole-7-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)c3ccc4cc(C(=O)O)ccc4c32)cc1 |
| InChI | InChI=1S/C19H12F3N3O4S/c20-19(21,22)17-15-8-1-10-9-11(18(26)27)2-7-14(10)16(15)25(24-17)12-3-5-13(6-4-12)30(23,28)29/h1-9H,(H,26,27)(H2,23,28,29) |
| InChIKey | GPRWKLBRPUYQDM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |