C15H21N5O3S2 — CID 21467696
N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)benzamide (PubChem CID 21467696) has the molecular formula C15H21N5O3S2 and a molecular weight of 383.50 g/mol. Its IUPAC name is N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)benzamide.
| Compound Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)benzamide |
|---|---|
| PubChem CID | 21467696 |
| Molecular Formula | C15H21N5O3S2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-(diaminomethylidene)-2-ethyl-5-methylsulfonyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylsulfanyl)benzamide |
| SMILES | CCc1cc(SC2=NCCCN2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C15H21N5O3S2/c1-3-9-7-11(24-15-18-5-4-6-19-15)12(25(2,22)23)8-10(9)13(21)20-14(16)17/h7-8H,3-6H2,1-2H3,(H,18,19)(H4,16,17,20,21) |
| InChIKey | SLLYWYILRQTJQS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|