About 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine
2-cyclohexa-1,3-dien-1-ylsulfanylpyridine (PubChem CID 21467889) has the molecular formula C11H11NS
and a molecular weight of 189.28 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine.
Molecular Properties
| Compound Name | 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine |
| PubChem CID | 21467889 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine |
| SMILES | C1=CCCC(Sc2ccccn2)=C1 |
| InChI | InChI=1S/C11H11NS/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11/h1-2,4-6,8-9H,3,7H2 |
| InChIKey | DGWXZFUCGBXFBV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine?
The IUPAC name of 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine (CID 21467889) is 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine.
What is the SMILES notation for 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine?
The canonical SMILES for 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine is C1=CCCC(Sc2ccccn2)=C1.
What is the InChIKey of 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine?
The InChIKey is DGWXZFUCGBXFBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS/c1-2-6-10(7-3-1)13-11-8-4-5-9-12-11/h1-2,4-6,8-9H,3,7H2.
What are the key properties of 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine?
2-cyclohexa-1,3-dien-1-ylsulfanylpyridine has a molecular weight of 189.28 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-1,3-dien-1-ylsulfanylpyridine is sourced from PubChem (CID 21467889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).