About [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate
[nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate (PubChem CID 21468069) has the molecular formula C11H8N2O5S
and a molecular weight of 280.26 g/mol. Its IUPAC name is [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate.
Molecular Properties
| Compound Name | [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate |
| PubChem CID | 21468069 |
| Molecular Formula | C11H8N2O5S |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate |
| SMILES | O=C(Oc1ccccc1)OC(c1cncs1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H8N2O5S/c14-11(17-8-4-2-1-3-5-8)18-10(13(15)16)9-6-12-7-19-9/h1-7,10H |
| InChIKey | DDULRUAUWXMFOY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate?
The IUPAC name of [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate (CID 21468069) is [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate.
What is the SMILES notation for [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate?
The canonical SMILES for [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate is O=C(Oc1ccccc1)OC(c1cncs1)[N+](=O)[O-].
What is the InChIKey of [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate?
The InChIKey is DDULRUAUWXMFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O5S/c14-11(17-8-4-2-1-3-5-8)18-10(13(15)16)9-6-12-7-19-9/h1-7,10H.
What are the key properties of [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate?
[nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate has a molecular weight of 280.26 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [nitro(1,3-thiazol-5-yl)methyl] phenyl carbonate is sourced from PubChem (CID 21468069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).