About [2,3-di(propan-2-yloxy)phenyl]phosphane
[2,3-di(propan-2-yloxy)phenyl]phosphane (PubChem CID 21468187) has the molecular formula C12H19O2P
and a molecular weight of 226.26 g/mol. Its IUPAC name is [2,3-di(propan-2-yloxy)phenyl]phosphane.
Molecular Properties
| Compound Name | [2,3-di(propan-2-yloxy)phenyl]phosphane |
| PubChem CID | 21468187 |
| Molecular Formula | C12H19O2P |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | [2,3-di(propan-2-yloxy)phenyl]phosphane |
| SMILES | CC(C)Oc1cccc(P)c1OC(C)C |
| InChI | InChI=1S/C12H19O2P/c1-8(2)13-10-6-5-7-11(15)12(10)14-9(3)4/h5-9H,15H2,1-4H3 |
| InChIKey | JYGVTYXMEQGVOB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,3-di(propan-2-yloxy)phenyl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-di(propan-2-yloxy)phenyl]phosphane?
The IUPAC name of [2,3-di(propan-2-yloxy)phenyl]phosphane (CID 21468187) is [2,3-di(propan-2-yloxy)phenyl]phosphane.
What is the SMILES notation for [2,3-di(propan-2-yloxy)phenyl]phosphane?
The canonical SMILES for [2,3-di(propan-2-yloxy)phenyl]phosphane is CC(C)Oc1cccc(P)c1OC(C)C.
What is the InChIKey of [2,3-di(propan-2-yloxy)phenyl]phosphane?
The InChIKey is JYGVTYXMEQGVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O2P/c1-8(2)13-10-6-5-7-11(15)12(10)14-9(3)4/h5-9H,15H2,1-4H3.
What are the key properties of [2,3-di(propan-2-yloxy)phenyl]phosphane?
[2,3-di(propan-2-yloxy)phenyl]phosphane has a molecular weight of 226.26 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-di(propan-2-yloxy)phenyl]phosphane is sourced from PubChem (CID 21468187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).