C13H20N4O4 — CID 21468207
1-[1-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 21468207) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[1-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[1-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21468207 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 1-[1-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCC(N1C(=O)NC(=O)C1(C)C)N1C(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C13H20N4O4/c1-6-7(16-10(20)14-8(18)12(16,2)3)17-11(21)15-9(19)13(17,4)5/h7H,6H2,1-5H3,(H,14,18,20)(H,15,19,21) |
| InChIKey | PWTKHAFPNFYCIH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|