C11H14N4S — CID 2146826
5,7-dimethyl-2-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 2146826) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is 5,7-dimethyl-2-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dimethyl-2-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 2146826 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5,7-dimethyl-2-(2-methylprop-2-enylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C=C(C)CSc1nc2nc(C)cc(C)n2n1 |
| InChI | InChI=1S/C11H14N4S/c1-7(2)6-16-11-13-10-12-8(3)5-9(4)15(10)14-11/h5H,1,6H2,2-4H3 |
| InChIKey | JDMBHPCOOUYNOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|