C22H17N3O4S — CID 21469318
5-[[7-[2-(1,3-benzoxazol-2-yl)ethoxy]quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 21469318) has the molecular formula C22H17N3O4S and a molecular weight of 419.46 g/mol. Its IUPAC name is 5-[[7-[2-(1,3-benzoxazol-2-yl)ethoxy]quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[7-[2-(1,3-benzoxazol-2-yl)ethoxy]quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21469318 |
| Molecular Formula | C22H17N3O4S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 5-[[7-[2-(1,3-benzoxazol-2-yl)ethoxy]quinolin-3-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cc2cnc3cc(OCCc4nc5ccccc5o4)ccc3c2)S1 |
| InChI | InChI=1S/C22H17N3O4S/c26-21-19(30-22(27)25-21)10-13-9-14-5-6-15(11-17(14)23-12-13)28-8-7-20-24-16-3-1-2-4-18(16)29-20/h1-6,9,11-12,19H,7-8,10H2,(H,25,26,27) |
| InChIKey | WBQSQMBYKYWXLQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|