C27H29N3O3 — CID 21469450
7-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-5H-[1,3]dioxolo[4,5-f]indole (PubChem CID 21469450) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 7-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-5H-[1,3]dioxolo[4,5-f]indole.
| Compound Name | 7-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-5H-[1,3]dioxolo[4,5-f]indole |
|---|---|
| PubChem CID | 21469450 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 7-[1-[4-(5-methoxy-1H-indol-3-yl)butyl]-3,6-dihydro-2H-pyridin-4-yl]-5H-[1,3]dioxolo[4,5-f]indole |
| SMILES | COc1ccc2[nH]cc(CCCCN3CC=C(c4c[nH]c5cc6c(cc45)OCO6)CC3)c2c1 |
| InChI | InChI=1S/C27H29N3O3/c1-31-20-5-6-24-21(12-20)19(15-28-24)4-2-3-9-30-10-7-18(8-11-30)23-16-29-25-14-27-26(13-22(23)25)32-17-33-27/h5-7,12-16,28-29H,2-4,8-11,17H2,1H3 |
| InChIKey | LGJKLATXEZEZTL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|