About ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate
ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate (PubChem CID 21469659) has the molecular formula C23H33NO3
and a molecular weight of 371.52 g/mol. Its IUPAC name is ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate |
| PubChem CID | 21469659 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCC(C2CCCCC2)N1C(=O)Cc1ccc(C)cc1C |
| InChI | InChI=1S/C23H33NO3/c1-4-27-23(26)21-13-12-20(18-8-6-5-7-9-18)24(21)22(25)15-19-11-10-16(2)14-17(19)3/h10-11,14,18,20-21H,4-9,12-13,15H2,1-3H3 |
| InChIKey | PYYBVELTRVBFET-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate?
The IUPAC name of ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate (CID 21469659) is ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate?
The canonical SMILES for ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate is CCOC(=O)C1CCC(C2CCCCC2)N1C(=O)Cc1ccc(C)cc1C.
What is the InChIKey of ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate?
The InChIKey is PYYBVELTRVBFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33NO3/c1-4-27-23(26)21-13-12-20(18-8-6-5-7-9-18)24(21)22(25)15-19-11-10-16(2)14-17(19)3/h10-11,14,18,20-21H,4-9,12-13,15H2,1-3H3.
What are the key properties of ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate?
ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate has a molecular weight of 371.52 g/mol, XLogP of 4.35, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-cyclohexyl-1-[2-(2,4-dimethylphenyl)acetyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 21469659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).