C19H43N3 — CID 21469944
5-N-(2-aminoethyl)-4-N,4-N,4-tripropyloctane-4,5-diamine (PubChem CID 21469944) has the molecular formula C19H43N3 and a molecular weight of 313.57 g/mol. Its IUPAC name is 5-N-(2-aminoethyl)-4-N,4-N,4-tripropyloctane-4,5-diamine.
| Compound Name | 5-N-(2-aminoethyl)-4-N,4-N,4-tripropyloctane-4,5-diamine |
|---|---|
| PubChem CID | 21469944 |
| Molecular Formula | C19H43N3 |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.35 |
| IUPAC Name | 5-N-(2-aminoethyl)-4-N,4-N,4-tripropyloctane-4,5-diamine |
| SMILES | CCCC(NCCN)C(CCC)(CCC)N(CCC)CCC |
| InChI | InChI=1S/C19H43N3/c1-6-11-18(21-15-14-20)19(12-7-2,13-8-3)22(16-9-4)17-10-5/h18,21H,6-17,20H2,1-5H3 |
| InChIKey | CWAZBTXMWPIBMI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |