C27H36N2O4 — CID 21470189
methyl 4-[(9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinoline-1-carbonyl)amino]benzoate (PubChem CID 21470189) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is methyl 4-[(9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinoline-1-carbonyl)amino]benzoate.
| Compound Name | methyl 4-[(9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinoline-1-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 21470189 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | methyl 4-[(9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,8,9,9b,10,11-tetradecahydroindeno[5,4-f]quinoline-1-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCC3C4CCC5NC(=O)CCC5(C)C4CCC23C)cc1 |
| InChI | InChI=1S/C27H36N2O4/c1-26-14-12-20-18(8-11-22-27(20,2)15-13-23(30)29-22)19(26)9-10-21(26)24(31)28-17-6-4-16(5-7-17)25(32)33-3/h4-7,18-22H,8-15H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | OEOUYXFPRITYQR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |