C15H20O9 — CID 21470344
5,6-dihydroxy-5-(hydroxymethyl)-6-(3-oxobutanoyl)decane-2,4,7,9-tetrone (PubChem CID 21470344) has the molecular formula C15H20O9 and a molecular weight of 344.32 g/mol. Its IUPAC name is 5,6-dihydroxy-5-(hydroxymethyl)-6-(3-oxobutanoyl)decane-2,4,7,9-tetrone.
| Compound Name | 5,6-dihydroxy-5-(hydroxymethyl)-6-(3-oxobutanoyl)decane-2,4,7,9-tetrone |
|---|---|
| PubChem CID | 21470344 |
| Molecular Formula | C15H20O9 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 5,6-dihydroxy-5-(hydroxymethyl)-6-(3-oxobutanoyl)decane-2,4,7,9-tetrone |
| SMILES | CC(=O)CC(=O)C(O)(CO)C(O)(C(=O)CC(C)=O)C(=O)CC(C)=O |
| InChI | InChI=1S/C15H20O9/c1-8(17)4-11(20)14(23,7-16)15(24,12(21)5-9(2)18)13(22)6-10(3)19/h16,23-24H,4-7H2,1-3H3 |
| InChIKey | QRBLWCZOQMDOFJ-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 163.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|