C15H19BrN2O3 — CID 21470552
4-[[(2-amino-5-bromobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 21470552) has the molecular formula C15H19BrN2O3 and a molecular weight of 355.23 g/mol. Its IUPAC name is 4-[[(2-amino-5-bromobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2-amino-5-bromobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 21470552 |
| Molecular Formula | C15H19BrN2O3 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-[[(2-amino-5-bromobenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | Nc1ccc(Br)cc1C(=O)NCC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H19BrN2O3/c16-11-5-6-13(17)12(7-11)14(19)18-8-9-1-3-10(4-2-9)15(20)21/h5-7,9-10H,1-4,8,17H2,(H,18,19)(H,20,21) |
| InChIKey | JNBCLQNXFFSLIC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|