About N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine
N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine (PubChem CID 21470638) has the molecular formula C23H33N3O2
and a molecular weight of 383.54 g/mol. Its IUPAC name is N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine.
Molecular Properties
| Compound Name | N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine |
| PubChem CID | 21470638 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine |
| SMILES | CCCCOC1=CC(N(CC)Cc2ccccc2)C(OCCCC)=CC1=[N+]=[N-] |
| InChI | InChI=1S/C23H33N3O2/c1-4-7-14-27-22-17-21(23(16-20(22)25-24)28-15-8-5-2)26(6-3)18-19-12-10-9-11-13-19/h9-13,16-17,21H,4-8,14-15,18H2,1-3H3 |
| InChIKey | PMZFBWGQISYMJA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 58.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine?
The IUPAC name of N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine (CID 21470638) is N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine.
What is the SMILES notation for N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine?
The canonical SMILES for N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine is CCCCOC1=CC(N(CC)Cc2ccccc2)C(OCCCC)=CC1=[N+]=[N-].
What is the InChIKey of N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine?
The InChIKey is PMZFBWGQISYMJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H33N3O2/c1-4-7-14-27-22-17-21(23(16-20(22)25-24)28-15-8-5-2)26(6-3)18-19-12-10-9-11-13-19/h9-13,16-17,21H,4-8,14-15,18H2,1-3H3.
What are the key properties of N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine?
N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine has a molecular weight of 383.54 g/mol, XLogP of 4.96, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,5-dibutoxy-4-diazo-N-ethylcyclohexa-2,5-dien-1-amine is sourced from PubChem (CID 21470638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).