About 1-iodopropan-2-yl carbamate
1-iodopropan-2-yl carbamate (PubChem CID 21471185) has the molecular formula C4H8INO2
and a molecular weight of 229.02 g/mol. Its IUPAC name is 1-iodopropan-2-yl carbamate.
Molecular Properties
| Compound Name | 1-iodopropan-2-yl carbamate |
| PubChem CID | 21471185 |
| Molecular Formula | C4H8INO2 |
| Molecular Weight | 229.02 g/mol |
| Exact Mass | 228.96 |
| IUPAC Name | 1-iodopropan-2-yl carbamate |
| SMILES | CC(CI)OC(N)=O |
| InChI | InChI=1S/C4H8INO2/c1-3(2-5)8-4(6)7/h3H,2H2,1H3,(H2,6,7) |
| InChIKey | MSOWPXQCLAYBTD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.02 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodopropan-2-yl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodopropan-2-yl carbamate?
The IUPAC name of 1-iodopropan-2-yl carbamate (CID 21471185) is 1-iodopropan-2-yl carbamate.
What is the SMILES notation for 1-iodopropan-2-yl carbamate?
The canonical SMILES for 1-iodopropan-2-yl carbamate is CC(CI)OC(N)=O.
What is the InChIKey of 1-iodopropan-2-yl carbamate?
The InChIKey is MSOWPXQCLAYBTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8INO2/c1-3(2-5)8-4(6)7/h3H,2H2,1H3,(H2,6,7).
What are the key properties of 1-iodopropan-2-yl carbamate?
1-iodopropan-2-yl carbamate has a molecular weight of 229.02 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodopropan-2-yl carbamate is sourced from PubChem (CID 21471185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).