C21H14F5NO — CID 21471386
4-(4-fluorophenyl)-2-propan-2-yl-6-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbaldehyde (PubChem CID 21471386) has the molecular formula C21H14F5NO and a molecular weight of 391.34 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-propan-2-yl-6-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbaldehyde.
| Compound Name | 4-(4-fluorophenyl)-2-propan-2-yl-6-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 21471386 |
| Molecular Formula | C21H14F5NO |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 4-(4-fluorophenyl)-2-propan-2-yl-6-(2,3,5,6-tetrafluorophenyl)pyridine-3-carbaldehyde |
| SMILES | CC(C)c1nc(-c2c(F)c(F)cc(F)c2F)cc(-c2ccc(F)cc2)c1C=O |
| InChI | InChI=1S/C21H14F5NO/c1-10(2)21-14(9-28)13(11-3-5-12(22)6-4-11)7-17(27-21)18-19(25)15(23)8-16(24)20(18)26/h3-10H,1-2H3 |
| InChIKey | SEZVQCHORWCDRL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|