C23H28Cl2N2O2 — CID 21472246
1-(4-benzylpiperazin-1-yl)-2-(3,4-dichlorophenoxy)hexan-1-one (PubChem CID 21472246) has the molecular formula C23H28Cl2N2O2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(3,4-dichlorophenoxy)hexan-1-one.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(3,4-dichlorophenoxy)hexan-1-one |
|---|---|
| PubChem CID | 21472246 |
| Molecular Formula | C23H28Cl2N2O2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(3,4-dichlorophenoxy)hexan-1-one |
| SMILES | CCCCC(Oc1ccc(Cl)c(Cl)c1)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28Cl2N2O2/c1-2-3-9-22(29-19-10-11-20(24)21(25)16-19)23(28)27-14-12-26(13-15-27)17-18-7-5-4-6-8-18/h4-8,10-11,16,22H,2-3,9,12-15,17H2,1H3 |
| InChIKey | FCAIMUBFRBQPAB-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |