C16H21N5O2 — CID 21472324
2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-2,3,4,6-tetrahydropyrano[2,3-b]pyridin-5-one (PubChem CID 21472324) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-2,3,4,6-tetrahydropyrano[2,3-b]pyridin-5-one.
| Compound Name | 2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-2,3,4,6-tetrahydropyrano[2,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 21472324 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-2,3,4,6-tetrahydropyrano[2,3-b]pyridin-5-one |
| SMILES | O=C1CC=NC2=C1CCC(CNCCCNc1ncccn1)O2 |
| InChI | InChI=1S/C16H21N5O2/c22-14-5-10-18-15-13(14)4-3-12(23-15)11-17-6-1-7-19-16-20-8-2-9-21-16/h2,8-10,12,17H,1,3-7,11H2,(H,19,20,21) |
| InChIKey | XHPOVHCWZVEMAW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|