About 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene
4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene (PubChem CID 21472413) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene.
Molecular Properties
| Compound Name | 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene |
| PubChem CID | 21472413 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene |
| SMILES | C=CCOCC=C.N#Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H5NO.C6H10O/c8-5-6-1-3-7(9)4-2-6;1-3-5-7-6-4-2/h1-4,9H;3-4H,1-2,5-6H2 |
| InChIKey | FSMNQDHOWHYGBZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene?
The IUPAC name of 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene (CID 21472413) is 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene.
What is the SMILES notation for 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene?
The canonical SMILES for 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene is C=CCOCC=C.N#Cc1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene?
The InChIKey is FSMNQDHOWHYGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO.C6H10O/c8-5-6-1-3-7(9)4-2-6;1-3-5-7-6-4-2/h1-4,9H;3-4H,1-2,5-6H2.
What are the key properties of 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene?
4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene has a molecular weight of 217.27 g/mol, XLogP of 2.64, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzonitrile;3-prop-2-enoxyprop-1-ene is sourced from PubChem (CID 21472413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).