About 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide
2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide (PubChem CID 21473427) has the molecular formula C24H34N4O2
and a molecular weight of 410.56 g/mol. Its IUPAC name is 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide.
Molecular Properties
| Compound Name | 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide |
| PubChem CID | 21473427 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide |
| SMILES | COc1ccccc1N1CCN(CCCNc2c(C)cccc2C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C24H34N4O2/c1-19-9-7-10-20(24(29)26(2)3)23(19)25-13-8-14-27-15-17-28(18-16-27)21-11-5-6-12-22(21)30-4/h5-7,9-12,25H,8,13-18H2,1-4H3 |
| InChIKey | ADBSINZYBRTZMT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide?
The IUPAC name of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide (CID 21473427) is 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide.
What is the SMILES notation for 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide?
The canonical SMILES for 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide is COc1ccccc1N1CCN(CCCNc2c(C)cccc2C(=O)N(C)C)CC1.
What is the InChIKey of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide?
The InChIKey is ADBSINZYBRTZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34N4O2/c1-19-9-7-10-20(24(29)26(2)3)23(19)25-13-8-14-27-15-17-28(18-16-27)21-11-5-6-12-22(21)30-4/h5-7,9-12,25H,8,13-18H2,1-4H3.
What are the key properties of 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide?
2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide has a molecular weight of 410.56 g/mol, XLogP of 3.33, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-N,N,3-trimethylbenzamide is sourced from PubChem (CID 21473427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).