C11H5Cl2N3O2 — CID 21473998
8,9-dichloro-3,6-dihydropyridazino[4,5-c]quinoline-4,5-dione (PubChem CID 21473998) has the molecular formula C11H5Cl2N3O2 and a molecular weight of 282.09 g/mol. Its IUPAC name is 8,9-dichloro-3,6-dihydropyridazino[4,5-c]quinoline-4,5-dione.
| Compound Name | 8,9-dichloro-3,6-dihydropyridazino[4,5-c]quinoline-4,5-dione |
|---|---|
| PubChem CID | 21473998 |
| Molecular Formula | C11H5Cl2N3O2 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 8,9-dichloro-3,6-dihydropyridazino[4,5-c]quinoline-4,5-dione |
| SMILES | O=c1[nH]ncc2c1c(=O)[nH]c1cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C11H5Cl2N3O2/c12-6-1-4-5-3-14-16-11(18)9(5)10(17)15-8(4)2-7(6)13/h1-3H,(H,15,17)(H,16,18) |
| InChIKey | ITKGGZXQHPXDEE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|