About 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone
1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone (PubChem CID 21474021) has the molecular formula C10H11Cl2NO3
and a molecular weight of 264.11 g/mol. Its IUPAC name is 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone.
Molecular Properties
| Compound Name | 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone |
| PubChem CID | 21474021 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone |
| SMILES | COC(OC)C(=O)c1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2NO3/c1-15-10(16-2)9(14)8-6(12)3-5(11)4-7(8)13/h3-4,10H,13H2,1-2H3 |
| InChIKey | VWSIZQXNYDVVOO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone?
The IUPAC name of 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone (CID 21474021) is 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone.
What is the SMILES notation for 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone?
The canonical SMILES for 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone is COC(OC)C(=O)c1c(N)cc(Cl)cc1Cl.
What is the InChIKey of 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone?
The InChIKey is VWSIZQXNYDVVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO3/c1-15-10(16-2)9(14)8-6(12)3-5(11)4-7(8)13/h3-4,10H,13H2,1-2H3.
What are the key properties of 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone?
1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone has a molecular weight of 264.11 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-amino-4,6-dichlorophenyl)-2,2-dimethoxyethanone is sourced from PubChem (CID 21474021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).