C12H6Cl2N2O2 — CID 21474063
8,9-dichloro-3,6-dihydrobenzo[c][2,7]naphthyridine-4,5-dione (PubChem CID 21474063) has the molecular formula C12H6Cl2N2O2 and a molecular weight of 281.10 g/mol. Its IUPAC name is 8,9-dichloro-3,6-dihydrobenzo[c][2,7]naphthyridine-4,5-dione.
| Compound Name | 8,9-dichloro-3,6-dihydrobenzo[c][2,7]naphthyridine-4,5-dione |
|---|---|
| PubChem CID | 21474063 |
| Molecular Formula | C12H6Cl2N2O2 |
| Molecular Weight | 281.10 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 8,9-dichloro-3,6-dihydrobenzo[c][2,7]naphthyridine-4,5-dione |
| SMILES | O=c1[nH]ccc2c1c(=O)[nH]c1cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C12H6Cl2N2O2/c13-7-3-6-5-1-2-15-11(17)10(5)12(18)16-9(6)4-8(7)14/h1-4H,(H,15,17)(H,16,18) |
| InChIKey | WXVVRVRYXXSWHX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.10 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|