C29H28N2O5S2 — CID 21474794
5-[[4-[2-[5-[(4-phenylphenoxy)methyl]-2-sulfanylidene-1,3-oxazolidin-3-yl]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 21474794) has the molecular formula C29H28N2O5S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 5-[[4-[2-[5-[(4-phenylphenoxy)methyl]-2-sulfanylidene-1,3-oxazolidin-3-yl]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[2-[5-[(4-phenylphenoxy)methyl]-2-sulfanylidene-1,3-oxazolidin-3-yl]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 21474794 |
| Molecular Formula | C29H28N2O5S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 5-[[4-[2-[5-[(4-phenylphenoxy)methyl]-2-sulfanylidene-1,3-oxazolidin-3-yl]propoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(COc1ccc(CC2SC(=O)NC2=O)cc1)N1CC(COc2ccc(-c3ccccc3)cc2)OC1=S |
| InChI | InChI=1S/C29H28N2O5S2/c1-19(17-34-23-11-7-20(8-12-23)15-26-27(32)30-28(33)38-26)31-16-25(36-29(31)37)18-35-24-13-9-22(10-14-24)21-5-3-2-4-6-21/h2-14,19,25-26H,15-18H2,1H3,(H,30,32,33) |
| InChIKey | OZPFQEANUWEAJB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|