About pyrrolidine-2,5-dione;hydrochloride
pyrrolidine-2,5-dione;hydrochloride (PubChem CID 21474954) has the molecular formula C4H6ClNO2
and a molecular weight of 135.55 g/mol. Its IUPAC name is pyrrolidine-2,5-dione;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidine-2,5-dione;hydrochloride |
| PubChem CID | 21474954 |
| Molecular Formula | C4H6ClNO2 |
| Molecular Weight | 135.55 g/mol |
| Exact Mass | 135.01 |
| IUPAC Name | pyrrolidine-2,5-dione;hydrochloride |
| SMILES | Cl.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C4H5NO2.ClH/c6-3-1-2-4(7)5-3;/h1-2H2,(H,5,6,7);1H |
| InChIKey | ZUTNAPRHBFFUBV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.55 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-2,5-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2,5-dione;hydrochloride?
The IUPAC name of pyrrolidine-2,5-dione;hydrochloride (CID 21474954) is pyrrolidine-2,5-dione;hydrochloride.
What is the SMILES notation for pyrrolidine-2,5-dione;hydrochloride?
The canonical SMILES for pyrrolidine-2,5-dione;hydrochloride is Cl.O=C1CCC(=O)N1.
What is the InChIKey of pyrrolidine-2,5-dione;hydrochloride?
The InChIKey is ZUTNAPRHBFFUBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.ClH/c6-3-1-2-4(7)5-3;/h1-2H2,(H,5,6,7);1H.
What are the key properties of pyrrolidine-2,5-dione;hydrochloride?
pyrrolidine-2,5-dione;hydrochloride has a molecular weight of 135.55 g/mol, XLogP of -0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2,5-dione;hydrochloride is sourced from PubChem (CID 21474954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).