About decan-2-one;propane-1,2,3-triol
decan-2-one;propane-1,2,3-triol (PubChem CID 21475593) has the molecular formula C13H28O4
and a molecular weight of 248.36 g/mol. Its IUPAC name is decan-2-one;propane-1,2,3-triol.
Molecular Properties
| Compound Name | decan-2-one;propane-1,2,3-triol |
| PubChem CID | 21475593 |
| Molecular Formula | C13H28O4 |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | decan-2-one;propane-1,2,3-triol |
| SMILES | CCCCCCCCC(C)=O.OCC(O)CO |
| InChI | InChI=1S/C10H20O.C3H8O3/c1-3-4-5-6-7-8-9-10(2)11;4-1-3(6)2-5/h3-9H2,1-2H3;3-6H,1-2H2 |
| InChIKey | IRXXJIZGYGLFMC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-2-one;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-2-one;propane-1,2,3-triol?
The IUPAC name of decan-2-one;propane-1,2,3-triol (CID 21475593) is decan-2-one;propane-1,2,3-triol.
What is the SMILES notation for decan-2-one;propane-1,2,3-triol?
The canonical SMILES for decan-2-one;propane-1,2,3-triol is CCCCCCCCC(C)=O.OCC(O)CO.
What is the InChIKey of decan-2-one;propane-1,2,3-triol?
The InChIKey is IRXXJIZGYGLFMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C3H8O3/c1-3-4-5-6-7-8-9-10(2)11;4-1-3(6)2-5/h3-9H2,1-2H3;3-6H,1-2H2.
What are the key properties of decan-2-one;propane-1,2,3-triol?
decan-2-one;propane-1,2,3-triol has a molecular weight of 248.36 g/mol, XLogP of 1.66, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for decan-2-one;propane-1,2,3-triol is sourced from PubChem (CID 21475593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).