About methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate
methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate (PubChem CID 21475674) has the molecular formula C17H24O5
and a molecular weight of 308.37 g/mol. Its IUPAC name is methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate.
Molecular Properties
| Compound Name | methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate |
| PubChem CID | 21475674 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate |
| SMILES | COC(=O)CCCC#CC/C(=C/C1COC(C)(C)O1)C(C)=O |
| InChI | InChI=1S/C17H24O5/c1-13(18)14(11-15-12-21-17(2,3)22-15)9-7-5-6-8-10-16(19)20-4/h11,15H,6,8-10,12H2,1-4H3/b14-11- |
| InChIKey | BOUMSLAMLLOWCC-KAMYIIQDSA-N |
| XLogP | 2.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate?
The IUPAC name of methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate (CID 21475674) is methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate.
What is the SMILES notation for methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate?
The canonical SMILES for methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate is COC(=O)CCCC#CC/C(=C/C1COC(C)(C)O1)C(C)=O.
What is the InChIKey of methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate?
The InChIKey is BOUMSLAMLLOWCC-KAMYIIQDSA-N. The full InChI is InChI=1S/C17H24O5/c1-13(18)14(11-15-12-21-17(2,3)22-15)9-7-5-6-8-10-16(19)20-4/h11,15H,6,8-10,12H2,1-4H3/b14-11-.
What are the key properties of methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate?
methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate has a molecular weight of 308.37 g/mol, XLogP of 2.39, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (8Z)-8-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylidene]-9-oxodec-5-ynoate is sourced from PubChem (CID 21475674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).