C19H30O4 — CID 21475788
4-dodecyl-2,3-dihydroxybenzoic acid (PubChem CID 21475788) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is 4-dodecyl-2,3-dihydroxybenzoic acid.
| Compound Name | 4-dodecyl-2,3-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 21475788 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 4-dodecyl-2,3-dihydroxybenzoic acid |
| SMILES | CCCCCCCCCCCCc1ccc(C(=O)O)c(O)c1O |
| InChI | InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-15-13-14-16(19(22)23)18(21)17(15)20/h13-14,20-21H,2-12H2,1H3,(H,22,23) |
| InChIKey | FZEFNAMAJTVXDF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|