About 2-benzyl-1,1-dimethylisoquinoline
2-benzyl-1,1-dimethylisoquinoline (PubChem CID 21476494) has the molecular formula C18H19N
and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-benzyl-1,1-dimethylisoquinoline.
Molecular Properties
| Compound Name | 2-benzyl-1,1-dimethylisoquinoline |
| PubChem CID | 21476494 |
| Molecular Formula | C18H19N |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-benzyl-1,1-dimethylisoquinoline |
| SMILES | CC1(C)c2ccccc2C=CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H19N/c1-18(2)17-11-7-6-10-16(17)12-13-19(18)14-15-8-4-3-5-9-15/h3-13H,14H2,1-2H3 |
| InChIKey | LJAMMJLPKJZMOW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzyl-1,1-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1,1-dimethylisoquinoline?
The IUPAC name of 2-benzyl-1,1-dimethylisoquinoline (CID 21476494) is 2-benzyl-1,1-dimethylisoquinoline.
What is the SMILES notation for 2-benzyl-1,1-dimethylisoquinoline?
The canonical SMILES for 2-benzyl-1,1-dimethylisoquinoline is CC1(C)c2ccccc2C=CN1Cc1ccccc1.
What is the InChIKey of 2-benzyl-1,1-dimethylisoquinoline?
The InChIKey is LJAMMJLPKJZMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N/c1-18(2)17-11-7-6-10-16(17)12-13-19(18)14-15-8-4-3-5-9-15/h3-13H,14H2,1-2H3.
What are the key properties of 2-benzyl-1,1-dimethylisoquinoline?
2-benzyl-1,1-dimethylisoquinoline has a molecular weight of 249.36 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1,1-dimethylisoquinoline is sourced from PubChem (CID 21476494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).