About 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole
5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole (PubChem CID 21476650) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole |
| PubChem CID | 21476650 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole |
| SMILES | Cc1noc(C2(C)CCN(C)C2)n1 |
| InChI | InChI=1S/C9H15N3O/c1-7-10-8(13-11-7)9(2)4-5-12(3)6-9/h4-6H2,1-3H3 |
| InChIKey | GNYRIUVELDCJEP-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole?
The IUPAC name of 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole (CID 21476650) is 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole?
The canonical SMILES for 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole is Cc1noc(C2(C)CCN(C)C2)n1.
What is the InChIKey of 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole?
The InChIKey is GNYRIUVELDCJEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-7-10-8(13-11-7)9(2)4-5-12(3)6-9/h4-6H2,1-3H3.
What are the key properties of 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole?
5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole has a molecular weight of 181.24 g/mol, XLogP of 0.97, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dimethylpyrrolidin-3-yl)-3-methyl-1,2,4-oxadiazole is sourced from PubChem (CID 21476650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).