C12H18O3 — CID 21477262
2,2-dimethyl-5,6,7,8,9,10-hexahydrocycloocta[d][1,3]dioxin-4-one (PubChem CID 21477262) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2,2-dimethyl-5,6,7,8,9,10-hexahydrocycloocta[d][1,3]dioxin-4-one.
| Compound Name | 2,2-dimethyl-5,6,7,8,9,10-hexahydrocycloocta[d][1,3]dioxin-4-one |
|---|---|
| PubChem CID | 21477262 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2,2-dimethyl-5,6,7,8,9,10-hexahydrocycloocta[d][1,3]dioxin-4-one |
| SMILES | CC1(C)OC(=O)C2=C(CCCCCC2)O1 |
| InChI | InChI=1S/C12H18O3/c1-12(2)14-10-8-6-4-3-5-7-9(10)11(13)15-12/h3-8H2,1-2H3 |
| InChIKey | CHQAKMAQABNKGC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |