About dodecyl 3-aminopropanoate
dodecyl 3-aminopropanoate (PubChem CID 21477549) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is dodecyl 3-aminopropanoate.
Molecular Properties
| Compound Name | dodecyl 3-aminopropanoate |
| PubChem CID | 21477549 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | dodecyl 3-aminopropanoate |
| SMILES | CCCCCCCCCCCCOC(=O)CCN |
| InChI | InChI=1S/C15H31NO2/c1-2-3-4-5-6-7-8-9-10-11-14-18-15(17)12-13-16/h2-14,16H2,1H3 |
| InChIKey | CAJZQACCKJCXLR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodecyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecyl 3-aminopropanoate?
The IUPAC name of dodecyl 3-aminopropanoate (CID 21477549) is dodecyl 3-aminopropanoate.
What is the SMILES notation for dodecyl 3-aminopropanoate?
The canonical SMILES for dodecyl 3-aminopropanoate is CCCCCCCCCCCCOC(=O)CCN.
What is the InChIKey of dodecyl 3-aminopropanoate?
The InChIKey is CAJZQACCKJCXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-2-3-4-5-6-7-8-9-10-11-14-18-15(17)12-13-16/h2-14,16H2,1H3.
What are the key properties of dodecyl 3-aminopropanoate?
dodecyl 3-aminopropanoate has a molecular weight of 257.42 g/mol, XLogP of 3.80, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dodecyl 3-aminopropanoate is sourced from PubChem (CID 21477549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).